C25H38O5 — CID 70148221
2-butan-2-yloxycarbonyl-2-[2-(4-heptoxyphenyl)ethyl]pent-4-enoic acid (PubChem CID 70148221) has the molecular formula C25H38O5 and a molecular weight of 418.57 g/mol. Its IUPAC name is 2-butan-2-yloxycarbonyl-2-[2-(4-heptoxyphenyl)ethyl]pent-4-enoic acid.
| Compound Name | 2-butan-2-yloxycarbonyl-2-[2-(4-heptoxyphenyl)ethyl]pent-4-enoic acid |
|---|---|
| PubChem CID | 70148221 |
| Molecular Formula | C25H38O5 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | 2-butan-2-yloxycarbonyl-2-[2-(4-heptoxyphenyl)ethyl]pent-4-enoic acid |
| SMILES | C=CCC(CCc1ccc(OCCCCCCC)cc1)(C(=O)O)C(=O)OC(C)CC |
| InChI | InChI=1S/C25H38O5/c1-5-8-9-10-11-19-29-22-14-12-21(13-15-22)16-18-25(17-6-2,23(26)27)24(28)30-20(4)7-3/h6,12-15,20H,2,5,7-11,16-19H2,1,3-4H3,(H,26,27) |
| InChIKey | MXCKIIDNCYFEMR-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|