C31H36O3 — CID 102420252
[(2S)-butan-2-yl] 4-[2-ethenyl-4-(4-hexoxyphenyl)phenyl]benzoate (PubChem CID 102420252) has the molecular formula C31H36O3 and a molecular weight of 456.63 g/mol. Its IUPAC name is [(2S)-butan-2-yl] 4-[2-ethenyl-4-(4-hexoxyphenyl)phenyl]benzoate.
| Compound Name | [(2S)-butan-2-yl] 4-[2-ethenyl-4-(4-hexoxyphenyl)phenyl]benzoate |
|---|---|
| PubChem CID | 102420252 |
| Molecular Formula | C31H36O3 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | [(2S)-butan-2-yl] 4-[2-ethenyl-4-(4-hexoxyphenyl)phenyl]benzoate |
| SMILES | C=Cc1cc(-c2ccc(OCCCCCC)cc2)ccc1-c1ccc(C(=O)O[C@@H](C)CC)cc1 |
| InChI | InChI=1S/C31H36O3/c1-5-8-9-10-21-33-29-18-15-25(16-19-29)28-17-20-30(24(7-3)22-28)26-11-13-27(14-12-26)31(32)34-23(4)6-2/h7,11-20,22-23H,3,5-6,8-10,21H2,1-2,4H3/t23-/m0/s1 |
| InChIKey | JZFBMCFZQMHYEI-QHCPKHFHSA-N |
| XLogP | 8.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|