C31H39NO4 — CID 101111943
butan-2-yl 6-[[4-(4-octoxyphenyl)phenoxy]methyl]pyridine-3-carboxylate (PubChem CID 101111943) has the molecular formula C31H39NO4 and a molecular weight of 489.66 g/mol. Its IUPAC name is butan-2-yl 6-[[4-(4-octoxyphenyl)phenoxy]methyl]pyridine-3-carboxylate.
| Compound Name | butan-2-yl 6-[[4-(4-octoxyphenyl)phenoxy]methyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 101111943 |
| Molecular Formula | C31H39NO4 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.29 |
| IUPAC Name | butan-2-yl 6-[[4-(4-octoxyphenyl)phenoxy]methyl]pyridine-3-carboxylate |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(OCc3ccc(C(=O)OC(C)CC)cn3)cc2)cc1 |
| InChI | InChI=1S/C31H39NO4/c1-4-6-7-8-9-10-21-34-29-17-12-25(13-18-29)26-14-19-30(20-15-26)35-23-28-16-11-27(22-32-28)31(33)36-24(3)5-2/h11-20,22,24H,4-10,21,23H2,1-3H3 |
| InChIKey | BNKQJSGTDSEQNH-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|