C31H50O6 — CID 70148000
2-butan-2-yloxycarbonyl-2-[2-(4-octylphenyl)ethyl]-5-(oxan-2-yloxy)pentanoic acid (PubChem CID 70148000) has the molecular formula C31H50O6 and a molecular weight of 518.74 g/mol. Its IUPAC name is 2-butan-2-yloxycarbonyl-2-[2-(4-octylphenyl)ethyl]-5-(oxan-2-yloxy)pentanoic acid.
| Compound Name | 2-butan-2-yloxycarbonyl-2-[2-(4-octylphenyl)ethyl]-5-(oxan-2-yloxy)pentanoic acid |
|---|---|
| PubChem CID | 70148000 |
| Molecular Formula | C31H50O6 |
| Molecular Weight | 518.74 g/mol |
| Exact Mass | 518.36 |
| IUPAC Name | 2-butan-2-yloxycarbonyl-2-[2-(4-octylphenyl)ethyl]-5-(oxan-2-yloxy)pentanoic acid |
| SMILES | CCCCCCCCc1ccc(CCC(CCCOC2CCCCO2)(C(=O)O)C(=O)OC(C)CC)cc1 |
| InChI | InChI=1S/C31H50O6/c1-4-6-7-8-9-10-14-26-16-18-27(19-17-26)20-22-31(29(32)33,30(34)37-25(3)5-2)21-13-24-36-28-15-11-12-23-35-28/h16-19,25,28H,4-15,20-24H2,1-3H3,(H,32,33) |
| InChIKey | TUUNBTMYHLXAEL-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.74 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|