C20H36ClNO2 — CID 22439347
2-amino-2-[2-(4-heptoxyphenyl)ethyl]-3-methylbutan-1-ol;hydrochloride (PubChem CID 22439347) has the molecular formula C20H36ClNO2 and a molecular weight of 357.97 g/mol. Its IUPAC name is 2-amino-2-[2-(4-heptoxyphenyl)ethyl]-3-methylbutan-1-ol;hydrochloride.
| Compound Name | 2-amino-2-[2-(4-heptoxyphenyl)ethyl]-3-methylbutan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 22439347 |
| Molecular Formula | C20H36ClNO2 |
| Molecular Weight | 357.97 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | 2-amino-2-[2-(4-heptoxyphenyl)ethyl]-3-methylbutan-1-ol;hydrochloride |
| SMILES | CCCCCCCOc1ccc(CCC(N)(CO)C(C)C)cc1.Cl |
| InChI | InChI=1S/C20H35NO2.ClH/c1-4-5-6-7-8-15-23-19-11-9-18(10-12-19)13-14-20(21,16-22)17(2)3;/h9-12,17,22H,4-8,13-16,21H2,1-3H3;1H |
| InChIKey | MTODDJXWHXGEDH-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.97 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|