C21H37NO2 — CID 53234284
(2S)-2-amino-2-[2-[4-(6-methylheptoxy)phenyl]ethyl]pentan-1-ol (PubChem CID 53234284) has the molecular formula C21H37NO2 and a molecular weight of 335.53 g/mol. Its IUPAC name is (2S)-2-amino-2-[2-[4-(6-methylheptoxy)phenyl]ethyl]pentan-1-ol.
| Compound Name | (2S)-2-amino-2-[2-[4-(6-methylheptoxy)phenyl]ethyl]pentan-1-ol |
|---|---|
| PubChem CID | 53234284 |
| Molecular Formula | C21H37NO2 |
| Molecular Weight | 335.53 g/mol |
| Exact Mass | 335.28 |
| IUPAC Name | (2S)-2-amino-2-[2-[4-(6-methylheptoxy)phenyl]ethyl]pentan-1-ol |
| SMILES | CCC[C@@](N)(CO)CCc1ccc(OCCCCCC(C)C)cc1 |
| InChI | InChI=1S/C21H37NO2/c1-4-14-21(22,17-23)15-13-19-9-11-20(12-10-19)24-16-7-5-6-8-18(2)3/h9-12,18,23H,4-8,13-17,22H2,1-3H3/t21-/m0/s1 |
| InChIKey | MDUCYXCGWGNEMH-NRFANRHFSA-N |
| XLogP | 4.70 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.53 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|