C21H37NO3 — CID 67606781
5-[(3S)-3-amino-3-(hydroxymethyl)hexyl]-2-(6-methylheptoxy)phenol (PubChem CID 67606781) has the molecular formula C21H37NO3 and a molecular weight of 351.53 g/mol. Its IUPAC name is 5-[(3S)-3-amino-3-(hydroxymethyl)hexyl]-2-(6-methylheptoxy)phenol.
| Compound Name | 5-[(3S)-3-amino-3-(hydroxymethyl)hexyl]-2-(6-methylheptoxy)phenol |
|---|---|
| PubChem CID | 67606781 |
| Molecular Formula | C21H37NO3 |
| Molecular Weight | 351.53 g/mol |
| Exact Mass | 351.28 |
| IUPAC Name | 5-[(3S)-3-amino-3-(hydroxymethyl)hexyl]-2-(6-methylheptoxy)phenol |
| SMILES | CCC[C@@](N)(CO)CCc1ccc(OCCCCCC(C)C)c(O)c1 |
| InChI | InChI=1S/C21H37NO3/c1-4-12-21(22,16-23)13-11-18-9-10-20(19(24)15-18)25-14-7-5-6-8-17(2)3/h9-10,15,17,23-24H,4-8,11-14,16,22H2,1-3H3/t21-/m0/s1 |
| InChIKey | BRZDDFJKDCYOEP-NRFANRHFSA-N |
| XLogP | 4.41 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|