C22H37NO3 — CID 67608435
2-amino-2-(cyclopropylmethyl)-4-[3-methoxy-4-(5-methylhexoxy)phenyl]butan-1-ol (PubChem CID 67608435) has the molecular formula C22H37NO3 and a molecular weight of 363.54 g/mol. Its IUPAC name is 2-amino-2-(cyclopropylmethyl)-4-[3-methoxy-4-(5-methylhexoxy)phenyl]butan-1-ol.
| Compound Name | 2-amino-2-(cyclopropylmethyl)-4-[3-methoxy-4-(5-methylhexoxy)phenyl]butan-1-ol |
|---|---|
| PubChem CID | 67608435 |
| Molecular Formula | C22H37NO3 |
| Molecular Weight | 363.54 g/mol |
| Exact Mass | 363.28 |
| IUPAC Name | 2-amino-2-(cyclopropylmethyl)-4-[3-methoxy-4-(5-methylhexoxy)phenyl]butan-1-ol |
| SMILES | COc1cc(CCC(N)(CO)CC2CC2)ccc1OCCCCC(C)C |
| InChI | InChI=1S/C22H37NO3/c1-17(2)6-4-5-13-26-20-10-9-18(14-21(20)25-3)11-12-22(23,16-24)15-19-7-8-19/h9-10,14,17,19,24H,4-8,11-13,15-16,23H2,1-3H3 |
| InChIKey | GVSIWDHDAVLXHA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.54 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|