C27H49NO3 — CID 67606707
2-amino-2-[2-[4-(5,9-dimethyldecoxy)-3-methoxyphenyl]ethyl]-4-methylpentan-1-ol (PubChem CID 67606707) has the molecular formula C27H49NO3 and a molecular weight of 435.69 g/mol. Its IUPAC name is 2-amino-2-[2-[4-(5,9-dimethyldecoxy)-3-methoxyphenyl]ethyl]-4-methylpentan-1-ol.
| Compound Name | 2-amino-2-[2-[4-(5,9-dimethyldecoxy)-3-methoxyphenyl]ethyl]-4-methylpentan-1-ol |
|---|---|
| PubChem CID | 67606707 |
| Molecular Formula | C27H49NO3 |
| Molecular Weight | 435.69 g/mol |
| Exact Mass | 435.37 |
| IUPAC Name | 2-amino-2-[2-[4-(5,9-dimethyldecoxy)-3-methoxyphenyl]ethyl]-4-methylpentan-1-ol |
| SMILES | COc1cc(CCC(N)(CO)CC(C)C)ccc1OCCCCC(C)CCCC(C)C |
| InChI | InChI=1S/C27H49NO3/c1-21(2)10-9-12-23(5)11-7-8-17-31-25-14-13-24(18-26(25)30-6)15-16-27(28,20-29)19-22(3)4/h13-14,18,21-23,29H,7-12,15-17,19-20,28H2,1-6H3 |
| InChIKey | OZNWMYXHBGLGIA-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.69 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|