C26H47NO3 — CID 67606430
(2S)-2-amino-2-[2-[2-methoxy-4-(9-methyldecoxy)phenyl]ethyl]-4-methylpentan-1-ol (PubChem CID 67606430) has the molecular formula C26H47NO3 and a molecular weight of 421.67 g/mol. Its IUPAC name is (2S)-2-amino-2-[2-[2-methoxy-4-(9-methyldecoxy)phenyl]ethyl]-4-methylpentan-1-ol.
| Compound Name | (2S)-2-amino-2-[2-[2-methoxy-4-(9-methyldecoxy)phenyl]ethyl]-4-methylpentan-1-ol |
|---|---|
| PubChem CID | 67606430 |
| Molecular Formula | C26H47NO3 |
| Molecular Weight | 421.67 g/mol |
| Exact Mass | 421.36 |
| IUPAC Name | (2S)-2-amino-2-[2-[2-methoxy-4-(9-methyldecoxy)phenyl]ethyl]-4-methylpentan-1-ol |
| SMILES | COc1cc(OCCCCCCCCC(C)C)ccc1CC[C@@](N)(CO)CC(C)C |
| InChI | InChI=1S/C26H47NO3/c1-21(2)12-10-8-6-7-9-11-17-30-24-14-13-23(25(18-24)29-5)15-16-26(27,20-28)19-22(3)4/h13-14,18,21-22,28H,6-12,15-17,19-20,27H2,1-5H3/t26-/m0/s1 |
| InChIKey | RODMSUALDSYAEF-SANMLTNESA-N |
| XLogP | 6.13 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.67 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|