C23H41NO3 — CID 67605906
2-amino-2-[2-[2-methoxy-4-[(2S)-6-methylheptan-2-yl]oxyphenyl]ethyl]-4-methylpentan-1-ol (PubChem CID 67605906) has the molecular formula C23H41NO3 and a molecular weight of 379.59 g/mol. Its IUPAC name is 2-amino-2-[2-[2-methoxy-4-[(2S)-6-methylheptan-2-yl]oxyphenyl]ethyl]-4-methylpentan-1-ol.
| Compound Name | 2-amino-2-[2-[2-methoxy-4-[(2S)-6-methylheptan-2-yl]oxyphenyl]ethyl]-4-methylpentan-1-ol |
|---|---|
| PubChem CID | 67605906 |
| Molecular Formula | C23H41NO3 |
| Molecular Weight | 379.59 g/mol |
| Exact Mass | 379.31 |
| IUPAC Name | 2-amino-2-[2-[2-methoxy-4-[(2S)-6-methylheptan-2-yl]oxyphenyl]ethyl]-4-methylpentan-1-ol |
| SMILES | COc1cc(O[C@@H](C)CCCC(C)C)ccc1CCC(N)(CO)CC(C)C |
| InChI | InChI=1S/C23H41NO3/c1-17(2)8-7-9-19(5)27-21-11-10-20(22(14-21)26-6)12-13-23(24,16-25)15-18(3)4/h10-11,14,17-19,25H,7-9,12-13,15-16,24H2,1-6H3/t19-,23?/m0/s1 |
| InChIKey | ZWYPNXPQTXJCEN-HSTJUUNISA-N |
| XLogP | 4.96 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.59 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |