C22H39NO3 — CID 67607892
(2S)-2-amino-2-[2-[2-methoxy-4-(6-methylheptan-2-yloxy)phenyl]ethyl]-3-methylbutan-1-ol (PubChem CID 67607892) has the molecular formula C22H39NO3 and a molecular weight of 365.56 g/mol. Its IUPAC name is (2S)-2-amino-2-[2-[2-methoxy-4-(6-methylheptan-2-yloxy)phenyl]ethyl]-3-methylbutan-1-ol.
| Compound Name | (2S)-2-amino-2-[2-[2-methoxy-4-(6-methylheptan-2-yloxy)phenyl]ethyl]-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 67607892 |
| Molecular Formula | C22H39NO3 |
| Molecular Weight | 365.56 g/mol |
| Exact Mass | 365.29 |
| IUPAC Name | (2S)-2-amino-2-[2-[2-methoxy-4-(6-methylheptan-2-yloxy)phenyl]ethyl]-3-methylbutan-1-ol |
| SMILES | COc1cc(OC(C)CCCC(C)C)ccc1CC[C@@](N)(CO)C(C)C |
| InChI | InChI=1S/C22H39NO3/c1-16(2)8-7-9-18(5)26-20-11-10-19(21(14-20)25-6)12-13-22(23,15-24)17(3)4/h10-11,14,16-18,24H,7-9,12-13,15,23H2,1-6H3/t18?,22-/m1/s1 |
| InChIKey | BAKIMDDTXQZGMA-LMNIDFBRSA-N |
| XLogP | 4.57 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.56 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |