C24H41NO3 — CID 67606714
2-amino-2-(cyclobutylmethyl)-4-[2-methoxy-4-[(2S)-6-methylheptan-2-yl]oxyphenyl]butan-1-ol (PubChem CID 67606714) has the molecular formula C24H41NO3 and a molecular weight of 391.60 g/mol. Its IUPAC name is 2-amino-2-(cyclobutylmethyl)-4-[2-methoxy-4-[(2S)-6-methylheptan-2-yl]oxyphenyl]butan-1-ol.
| Compound Name | 2-amino-2-(cyclobutylmethyl)-4-[2-methoxy-4-[(2S)-6-methylheptan-2-yl]oxyphenyl]butan-1-ol |
|---|---|
| PubChem CID | 67606714 |
| Molecular Formula | C24H41NO3 |
| Molecular Weight | 391.60 g/mol |
| Exact Mass | 391.31 |
| IUPAC Name | 2-amino-2-(cyclobutylmethyl)-4-[2-methoxy-4-[(2S)-6-methylheptan-2-yl]oxyphenyl]butan-1-ol |
| SMILES | COc1cc(O[C@@H](C)CCCC(C)C)ccc1CCC(N)(CO)CC1CCC1 |
| InChI | InChI=1S/C24H41NO3/c1-18(2)7-5-8-19(3)28-22-12-11-21(23(15-22)27-4)13-14-24(25,17-26)16-20-9-6-10-20/h11-12,15,18-20,26H,5-10,13-14,16-17,25H2,1-4H3/t19-,24?/m0/s1 |
| InChIKey | SDBOBRDJDUJBRI-XGLRFROISA-N |
| XLogP | 5.10 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.60 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |