C26H47NO3 — CID 67608481
(2S)-2-amino-2-[2-[4-(5,9-dimethyldecoxy)-2-methoxyphenyl]ethyl]-3-methylbutan-1-ol (PubChem CID 67608481) has the molecular formula C26H47NO3 and a molecular weight of 421.67 g/mol. Its IUPAC name is (2S)-2-amino-2-[2-[4-(5,9-dimethyldecoxy)-2-methoxyphenyl]ethyl]-3-methylbutan-1-ol.
| Compound Name | (2S)-2-amino-2-[2-[4-(5,9-dimethyldecoxy)-2-methoxyphenyl]ethyl]-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 67608481 |
| Molecular Formula | C26H47NO3 |
| Molecular Weight | 421.67 g/mol |
| Exact Mass | 421.36 |
| IUPAC Name | (2S)-2-amino-2-[2-[4-(5,9-dimethyldecoxy)-2-methoxyphenyl]ethyl]-3-methylbutan-1-ol |
| SMILES | COc1cc(OCCCCC(C)CCCC(C)C)ccc1CC[C@@](N)(CO)C(C)C |
| InChI | InChI=1S/C26H47NO3/c1-20(2)10-9-12-22(5)11-7-8-17-30-24-14-13-23(25(18-24)29-6)15-16-26(27,19-28)21(3)4/h13-14,18,20-22,28H,7-12,15-17,19,27H2,1-6H3/t22?,26-/m1/s1 |
| InChIKey | SOMJOPCRMVMRID-ZWAGFTRDSA-N |
| XLogP | 5.99 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.67 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|