C22H39NO2 — CID 67609110
(2S)-2-amino-3-methyl-2-[2-[4-(3-methyloctoxy)phenyl]ethyl]butan-1-ol (PubChem CID 67609110) has the molecular formula C22H39NO2 and a molecular weight of 349.56 g/mol. Its IUPAC name is (2S)-2-amino-3-methyl-2-[2-[4-(3-methyloctoxy)phenyl]ethyl]butan-1-ol.
| Compound Name | (2S)-2-amino-3-methyl-2-[2-[4-(3-methyloctoxy)phenyl]ethyl]butan-1-ol |
|---|---|
| PubChem CID | 67609110 |
| Molecular Formula | C22H39NO2 |
| Molecular Weight | 349.56 g/mol |
| Exact Mass | 349.30 |
| IUPAC Name | (2S)-2-amino-3-methyl-2-[2-[4-(3-methyloctoxy)phenyl]ethyl]butan-1-ol |
| SMILES | CCCCCC(C)CCOc1ccc(CC[C@@](N)(CO)C(C)C)cc1 |
| InChI | InChI=1S/C22H39NO2/c1-5-6-7-8-19(4)14-16-25-21-11-9-20(10-12-21)13-15-22(23,17-24)18(2)3/h9-12,18-19,24H,5-8,13-17,23H2,1-4H3/t19?,22-/m1/s1 |
| InChIKey | QZGNIWUDHCBMKJ-AVKWCDSFSA-N |
| XLogP | 4.95 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|