C23H39NO3 — CID 67608514
2-amino-2-(cyclobutylmethyl)-4-[2-methoxy-4-(5-methylhexoxy)phenyl]butan-1-ol (PubChem CID 67608514) has the molecular formula C23H39NO3 and a molecular weight of 377.57 g/mol. Its IUPAC name is 2-amino-2-(cyclobutylmethyl)-4-[2-methoxy-4-(5-methylhexoxy)phenyl]butan-1-ol.
| Compound Name | 2-amino-2-(cyclobutylmethyl)-4-[2-methoxy-4-(5-methylhexoxy)phenyl]butan-1-ol |
|---|---|
| PubChem CID | 67608514 |
| Molecular Formula | C23H39NO3 |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.29 |
| IUPAC Name | 2-amino-2-(cyclobutylmethyl)-4-[2-methoxy-4-(5-methylhexoxy)phenyl]butan-1-ol |
| SMILES | COc1cc(OCCCCC(C)C)ccc1CCC(N)(CO)CC1CCC1 |
| InChI | InChI=1S/C23H39NO3/c1-18(2)7-4-5-14-27-21-11-10-20(22(15-21)26-3)12-13-23(24,17-25)16-19-8-6-9-19/h10-11,15,18-19,25H,4-9,12-14,16-17,24H2,1-3H3 |
| InChIKey | ASURXYHWVCMGBT-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|