C25H45NO3 — CID 67606839
(2S)-2-amino-2-[2-[3-methoxy-4-(9-methyldecoxy)phenyl]ethyl]-3-methylbutan-1-ol (PubChem CID 67606839) has the molecular formula C25H45NO3 and a molecular weight of 407.64 g/mol. Its IUPAC name is (2S)-2-amino-2-[2-[3-methoxy-4-(9-methyldecoxy)phenyl]ethyl]-3-methylbutan-1-ol.
| Compound Name | (2S)-2-amino-2-[2-[3-methoxy-4-(9-methyldecoxy)phenyl]ethyl]-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 67606839 |
| Molecular Formula | C25H45NO3 |
| Molecular Weight | 407.64 g/mol |
| Exact Mass | 407.34 |
| IUPAC Name | (2S)-2-amino-2-[2-[3-methoxy-4-(9-methyldecoxy)phenyl]ethyl]-3-methylbutan-1-ol |
| SMILES | COc1cc(CC[C@@](N)(CO)C(C)C)ccc1OCCCCCCCCC(C)C |
| InChI | InChI=1S/C25H45NO3/c1-20(2)12-10-8-6-7-9-11-17-29-23-14-13-22(18-24(23)28-5)15-16-25(26,19-27)21(3)4/h13-14,18,20-21,27H,6-12,15-17,19,26H2,1-5H3/t25-/m1/s1 |
| InChIKey | CQZJWKITCOLYAX-RUZDIDTESA-N |
| XLogP | 5.74 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.64 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|