C21H32O5 — CID 10690152
2-ethoxycarbonyl-4-(4-heptoxyphenyl)-2-methylbutanoic acid (PubChem CID 10690152) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is 2-ethoxycarbonyl-4-(4-heptoxyphenyl)-2-methylbutanoic acid.
| Compound Name | 2-ethoxycarbonyl-4-(4-heptoxyphenyl)-2-methylbutanoic acid |
|---|---|
| PubChem CID | 10690152 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 2-ethoxycarbonyl-4-(4-heptoxyphenyl)-2-methylbutanoic acid |
| SMILES | CCCCCCCOc1ccc(CCC(C)(C(=O)O)C(=O)OCC)cc1 |
| InChI | InChI=1S/C21H32O5/c1-4-6-7-8-9-16-26-18-12-10-17(11-13-18)14-15-21(3,19(22)23)20(24)25-5-2/h10-13H,4-9,14-16H2,1-3H3,(H,22,23) |
| InChIKey | IITZTILFIHXHNG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|