C26H43NO5 — CID 22618779
ethyl 2-[2-(4-heptoxyphenyl)ethyl]-2-(methoxycarbonylamino)heptanoate (PubChem CID 22618779) has the molecular formula C26H43NO5 and a molecular weight of 449.63 g/mol. Its IUPAC name is ethyl 2-[2-(4-heptoxyphenyl)ethyl]-2-(methoxycarbonylamino)heptanoate.
| Compound Name | ethyl 2-[2-(4-heptoxyphenyl)ethyl]-2-(methoxycarbonylamino)heptanoate |
|---|---|
| PubChem CID | 22618779 |
| Molecular Formula | C26H43NO5 |
| Molecular Weight | 449.63 g/mol |
| Exact Mass | 449.31 |
| IUPAC Name | ethyl 2-[2-(4-heptoxyphenyl)ethyl]-2-(methoxycarbonylamino)heptanoate |
| SMILES | CCCCCCCOc1ccc(CCC(CCCCC)(NC(=O)OC)C(=O)OCC)cc1 |
| InChI | InChI=1S/C26H43NO5/c1-5-8-10-11-13-21-32-23-16-14-22(15-17-23)18-20-26(19-12-9-6-2,24(28)31-7-3)27-25(29)30-4/h14-17H,5-13,18-21H2,1-4H3,(H,27,29) |
| InChIKey | HWTBTGNBCDFDKP-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.63 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|