C46H76N2O7 — CID 70146137
ethyl 7-amino-2,7-bis[2-(4-heptoxyphenyl)ethyl]-6-hydroxy-2-(methoxycarbonylamino)-4,9-dimethyldecanoate (PubChem CID 70146137) has the molecular formula C46H76N2O7 and a molecular weight of 769.12 g/mol. Its IUPAC name is ethyl 7-amino-2,7-bis[2-(4-heptoxyphenyl)ethyl]-6-hydroxy-2-(methoxycarbonylamino)-4,9-dimethyldecanoate.
| Compound Name | ethyl 7-amino-2,7-bis[2-(4-heptoxyphenyl)ethyl]-6-hydroxy-2-(methoxycarbonylamino)-4,9-dimethyldecanoate |
|---|---|
| PubChem CID | 70146137 |
| Molecular Formula | C46H76N2O7 |
| Molecular Weight | 769.12 g/mol |
| Exact Mass | 768.57 |
| IUPAC Name | ethyl 7-amino-2,7-bis[2-(4-heptoxyphenyl)ethyl]-6-hydroxy-2-(methoxycarbonylamino)-4,9-dimethyldecanoate |
| SMILES | CCCCCCCOc1ccc(CCC(CC(C)CC(O)C(N)(CCc2ccc(OCCCCCCC)cc2)CC(C)C)(NC(=O)OC)C(=O)OCC)cc1 |
| InChI | InChI=1S/C46H76N2O7/c1-8-11-13-15-17-31-54-40-23-19-38(20-24-40)27-29-45(47,34-36(4)5)42(49)33-37(6)35-46(43(50)53-10-3,48-44(51)52-7)30-28-39-21-25-41(26-22-39)55-32-18-16-14-12-9-2/h19-26,36-37,42,49H,8-18,27-35,47H2,1-7H3,(H,48,51) |
| InChIKey | NDDOFIQAMILJNZ-UHFFFAOYSA-N |
| XLogP | 10.13 |
| TPSA | 129.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.12 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|