C23H39NO4 — CID 58972210
tert-butyl N-[4-(4-heptoxyphenyl)-1-hydroxy-2-methylbutan-2-yl]carbamate (PubChem CID 58972210) has the molecular formula C23H39NO4 and a molecular weight of 393.57 g/mol. Its IUPAC name is tert-butyl N-[4-(4-heptoxyphenyl)-1-hydroxy-2-methylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-(4-heptoxyphenyl)-1-hydroxy-2-methylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 58972210 |
| Molecular Formula | C23H39NO4 |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.29 |
| IUPAC Name | tert-butyl N-[4-(4-heptoxyphenyl)-1-hydroxy-2-methylbutan-2-yl]carbamate |
| SMILES | CCCCCCCOc1ccc(CCC(C)(CO)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C23H39NO4/c1-6-7-8-9-10-17-27-20-13-11-19(12-14-20)15-16-23(5,18-25)24-21(26)28-22(2,3)4/h11-14,25H,6-10,15-18H2,1-5H3,(H,24,26) |
| InChIKey | NIXRTURDUYSHSR-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|