C20H30F3NO4 — CID 152764439
[4-[4-heptoxy-3-(trifluoromethyl)phenyl]-1-hydroxy-2-methylbutan-2-yl]carbamic acid (PubChem CID 152764439) has the molecular formula C20H30F3NO4 and a molecular weight of 405.46 g/mol. Its IUPAC name is [4-[4-heptoxy-3-(trifluoromethyl)phenyl]-1-hydroxy-2-methylbutan-2-yl]carbamic acid.
| Compound Name | [4-[4-heptoxy-3-(trifluoromethyl)phenyl]-1-hydroxy-2-methylbutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 152764439 |
| Molecular Formula | C20H30F3NO4 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | [4-[4-heptoxy-3-(trifluoromethyl)phenyl]-1-hydroxy-2-methylbutan-2-yl]carbamic acid |
| SMILES | CCCCCCCOc1ccc(CCC(C)(CO)NC(=O)O)cc1C(F)(F)F |
| InChI | InChI=1S/C20H30F3NO4/c1-3-4-5-6-7-12-28-17-9-8-15(13-16(17)20(21,22)23)10-11-19(2,14-25)24-18(26)27/h8-9,13,24-25H,3-7,10-12,14H2,1-2H3,(H,26,27) |
| InChIKey | OGYJHZHALOVWHA-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|