C17H25ClFNO4 — CID 141102811
[(2R)-4-(3-chloro-5-fluoro-4-pentoxyphenyl)-1-hydroxy-2-methylbutan-2-yl]carbamic acid (PubChem CID 141102811) has the molecular formula C17H25ClFNO4 and a molecular weight of 361.84 g/mol. Its IUPAC name is [(2R)-4-(3-chloro-5-fluoro-4-pentoxyphenyl)-1-hydroxy-2-methylbutan-2-yl]carbamic acid.
| Compound Name | [(2R)-4-(3-chloro-5-fluoro-4-pentoxyphenyl)-1-hydroxy-2-methylbutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 141102811 |
| Molecular Formula | C17H25ClFNO4 |
| Molecular Weight | 361.84 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | [(2R)-4-(3-chloro-5-fluoro-4-pentoxyphenyl)-1-hydroxy-2-methylbutan-2-yl]carbamic acid |
| SMILES | CCCCCOc1c(F)cc(CC[C@](C)(CO)NC(=O)O)cc1Cl |
| InChI | InChI=1S/C17H25ClFNO4/c1-3-4-5-8-24-15-13(18)9-12(10-14(15)19)6-7-17(2,11-21)20-16(22)23/h9-10,20-21H,3-8,11H2,1-2H3,(H,22,23)/t17-/m1/s1 |
| InChIKey | HOUQRJJQHRVWIB-QGZVFWFLSA-N |
| XLogP | 4.00 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.84 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|