C18H27F4NO3 — CID 70963737
2-amino-2-[2-[4-(6-fluorohexoxy)-3-(trifluoromethyl)phenyl]ethyl]propane-1,3-diol (PubChem CID 70963737) has the molecular formula C18H27F4NO3 and a molecular weight of 381.41 g/mol. Its IUPAC name is 2-amino-2-[2-[4-(6-fluorohexoxy)-3-(trifluoromethyl)phenyl]ethyl]propane-1,3-diol.
| Compound Name | 2-amino-2-[2-[4-(6-fluorohexoxy)-3-(trifluoromethyl)phenyl]ethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 70963737 |
| Molecular Formula | C18H27F4NO3 |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 2-amino-2-[2-[4-(6-fluorohexoxy)-3-(trifluoromethyl)phenyl]ethyl]propane-1,3-diol |
| SMILES | NC(CO)(CO)CCc1ccc(OCCCCCCF)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H27F4NO3/c19-9-3-1-2-4-10-26-16-6-5-14(11-15(16)18(20,21)22)7-8-17(23,12-24)13-25/h5-6,11,24-25H,1-4,7-10,12-13,23H2 |
| InChIKey | WGWDZNPXPCUDNA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|