C22H25F3N2O3 — CID 59407897
4-[3-[4-[3-amino-4-hydroxy-3-(hydroxymethyl)butyl]-2-(trifluoromethyl)phenoxy]propyl]benzonitrile (PubChem CID 59407897) has the molecular formula C22H25F3N2O3 and a molecular weight of 422.45 g/mol. Its IUPAC name is 4-[3-[4-[3-amino-4-hydroxy-3-(hydroxymethyl)butyl]-2-(trifluoromethyl)phenoxy]propyl]benzonitrile.
| Compound Name | 4-[3-[4-[3-amino-4-hydroxy-3-(hydroxymethyl)butyl]-2-(trifluoromethyl)phenoxy]propyl]benzonitrile |
|---|---|
| PubChem CID | 59407897 |
| Molecular Formula | C22H25F3N2O3 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 4-[3-[4-[3-amino-4-hydroxy-3-(hydroxymethyl)butyl]-2-(trifluoromethyl)phenoxy]propyl]benzonitrile |
| SMILES | N#Cc1ccc(CCCOc2ccc(CCC(N)(CO)CO)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H25F3N2O3/c23-22(24,25)19-12-17(9-10-21(27,14-28)15-29)7-8-20(19)30-11-1-2-16-3-5-18(13-26)6-4-16/h3-8,12,28-29H,1-2,9-11,14-15,27H2 |
| InChIKey | QTVLTIFYYYXWTA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|