C23H29F3NO6P — CID 66593861
2-amino-4-[4-[3-(3,4-dimethoxyphenyl)propoxy]-3-(trifluoromethyl)phenyl]-2-(phosphorosooxymethyl)butan-1-ol (PubChem CID 66593861) has the molecular formula C23H29F3NO6P and a molecular weight of 503.45 g/mol. Its IUPAC name is 2-amino-4-[4-[3-(3,4-dimethoxyphenyl)propoxy]-3-(trifluoromethyl)phenyl]-2-(phosphorosooxymethyl)butan-1-ol.
| Compound Name | 2-amino-4-[4-[3-(3,4-dimethoxyphenyl)propoxy]-3-(trifluoromethyl)phenyl]-2-(phosphorosooxymethyl)butan-1-ol |
|---|---|
| PubChem CID | 66593861 |
| Molecular Formula | C23H29F3NO6P |
| Molecular Weight | 503.45 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | 2-amino-4-[4-[3-(3,4-dimethoxyphenyl)propoxy]-3-(trifluoromethyl)phenyl]-2-(phosphorosooxymethyl)butan-1-ol |
| SMILES | COc1ccc(CCCOc2ccc(CCC(N)(CO)COP=O)cc2C(F)(F)F)cc1OC |
| InChI | InChI=1S/C23H29F3NO6P/c1-30-20-8-6-16(13-21(20)31-2)4-3-11-32-19-7-5-17(12-18(19)23(24,25)26)9-10-22(27,14-28)15-33-34-29/h5-8,12-13,28H,3-4,9-11,14-15,27H2,1-2H3 |
| InChIKey | HHEVDHIGVLCPOA-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 100.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.45 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|