C23H29F3NO4P — CID 66593763
2-amino-4-[4-[3-(2,3-dimethylphenyl)propoxy]-3-(trifluoromethyl)phenyl]-2-(phosphorosooxymethyl)butan-1-ol (PubChem CID 66593763) has the molecular formula C23H29F3NO4P and a molecular weight of 471.46 g/mol. Its IUPAC name is 2-amino-4-[4-[3-(2,3-dimethylphenyl)propoxy]-3-(trifluoromethyl)phenyl]-2-(phosphorosooxymethyl)butan-1-ol.
| Compound Name | 2-amino-4-[4-[3-(2,3-dimethylphenyl)propoxy]-3-(trifluoromethyl)phenyl]-2-(phosphorosooxymethyl)butan-1-ol |
|---|---|
| PubChem CID | 66593763 |
| Molecular Formula | C23H29F3NO4P |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 2-amino-4-[4-[3-(2,3-dimethylphenyl)propoxy]-3-(trifluoromethyl)phenyl]-2-(phosphorosooxymethyl)butan-1-ol |
| SMILES | Cc1cccc(CCCOc2ccc(CCC(N)(CO)COP=O)cc2C(F)(F)F)c1C |
| InChI | InChI=1S/C23H29F3NO4P/c1-16-5-3-6-19(17(16)2)7-4-12-30-21-9-8-18(13-20(21)23(24,25)26)10-11-22(27,14-28)15-31-32-29/h3,5-6,8-9,13,28H,4,7,10-12,14-15,27H2,1-2H3 |
| InChIKey | HJQBORDCMRCIKP-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|