C20H25F3NO4PS — CID 66593874
2-amino-4-[4-[3-(5-methylthiophen-2-yl)propoxy]-3-(trifluoromethyl)phenyl]-2-(phosphorosooxymethyl)butan-1-ol (PubChem CID 66593874) has the molecular formula C20H25F3NO4PS and a molecular weight of 463.46 g/mol. Its IUPAC name is 2-amino-4-[4-[3-(5-methylthiophen-2-yl)propoxy]-3-(trifluoromethyl)phenyl]-2-(phosphorosooxymethyl)butan-1-ol.
| Compound Name | 2-amino-4-[4-[3-(5-methylthiophen-2-yl)propoxy]-3-(trifluoromethyl)phenyl]-2-(phosphorosooxymethyl)butan-1-ol |
|---|---|
| PubChem CID | 66593874 |
| Molecular Formula | C20H25F3NO4PS |
| Molecular Weight | 463.46 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | 2-amino-4-[4-[3-(5-methylthiophen-2-yl)propoxy]-3-(trifluoromethyl)phenyl]-2-(phosphorosooxymethyl)butan-1-ol |
| SMILES | Cc1ccc(CCCOc2ccc(CCC(N)(CO)COP=O)cc2C(F)(F)F)s1 |
| InChI | InChI=1S/C20H25F3NO4PS/c1-14-4-6-16(30-14)3-2-10-27-18-7-5-15(11-17(18)20(21,22)23)8-9-19(24,12-25)13-28-29-26/h4-7,11,25H,2-3,8-10,12-13,24H2,1H3 |
| InChIKey | HWBYTNALDZAOHV-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|