C23H28F3NO5P+ — CID 172997087
[2-amino-4-[4-[3-(2,3-dihydro-1-benzofuran-5-yl)propoxy]-3-(trifluoromethyl)phenyl]-2-(hydroxymethyl)butoxy]-oxophosphanium (PubChem CID 172997087) has the molecular formula C23H28F3NO5P+ and a molecular weight of 486.45 g/mol. Its IUPAC name is [2-amino-4-[4-[3-(2,3-dihydro-1-benzofuran-5-yl)propoxy]-3-(trifluoromethyl)phenyl]-2-(hydroxymethyl)butoxy]-oxophosphanium.
| Compound Name | [2-amino-4-[4-[3-(2,3-dihydro-1-benzofuran-5-yl)propoxy]-3-(trifluoromethyl)phenyl]-2-(hydroxymethyl)butoxy]-oxophosphanium |
|---|---|
| PubChem CID | 172997087 |
| Molecular Formula | C23H28F3NO5P+ |
| Molecular Weight | 486.45 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | [2-amino-4-[4-[3-(2,3-dihydro-1-benzofuran-5-yl)propoxy]-3-(trifluoromethyl)phenyl]-2-(hydroxymethyl)butoxy]-oxophosphanium |
| SMILES | NC(CO)(CCc1ccc(OCCCc2ccc3c(c2)CCO3)c(C(F)(F)F)c1)CO[PH+]=O |
| InChI | InChI=1S/C23H28F3NO5P/c24-23(25,26)19-13-17(7-9-22(27,14-28)15-32-33-29)4-6-21(19)30-10-1-2-16-3-5-20-18(12-16)8-11-31-20/h3-6,12-13,28,33H,1-2,7-11,14-15,27H2/q+1 |
| InChIKey | MVXAOFNNPGAEIZ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|