C24H26F3NO4P+ — CID 172997113
[2-amino-2-(hydroxymethyl)-4-[4-(2-naphthalen-2-ylethoxy)-3-(trifluoromethyl)phenyl]butoxy]-oxophosphanium (PubChem CID 172997113) has the molecular formula C24H26F3NO4P+ and a molecular weight of 480.44 g/mol. Its IUPAC name is [2-amino-2-(hydroxymethyl)-4-[4-(2-naphthalen-2-ylethoxy)-3-(trifluoromethyl)phenyl]butoxy]-oxophosphanium.
| Compound Name | [2-amino-2-(hydroxymethyl)-4-[4-(2-naphthalen-2-ylethoxy)-3-(trifluoromethyl)phenyl]butoxy]-oxophosphanium |
|---|---|
| PubChem CID | 172997113 |
| Molecular Formula | C24H26F3NO4P+ |
| Molecular Weight | 480.44 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | [2-amino-2-(hydroxymethyl)-4-[4-(2-naphthalen-2-ylethoxy)-3-(trifluoromethyl)phenyl]butoxy]-oxophosphanium |
| SMILES | NC(CO)(CCc1ccc(OCCc2ccc3ccccc3c2)c(C(F)(F)F)c1)CO[PH+]=O |
| InChI | InChI=1S/C24H26F3NO4P/c25-24(26,27)21-14-17(9-11-23(28,15-29)16-32-33-30)6-8-22(21)31-12-10-18-5-7-19-3-1-2-4-20(19)13-18/h1-8,13-14,29,33H,9-12,15-16,28H2/q+1 |
| InChIKey | OAYWUKCAPQCKGU-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.44 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|