C21H26ClF4NO3 — CID 66594042
2-amino-2-[2-[4-[3-(3-fluorophenyl)propoxy]-3-(trifluoromethyl)phenyl]ethyl]propane-1,3-diol;hydrochloride (PubChem CID 66594042) has the molecular formula C21H26ClF4NO3 and a molecular weight of 451.89 g/mol. Its IUPAC name is 2-amino-2-[2-[4-[3-(3-fluorophenyl)propoxy]-3-(trifluoromethyl)phenyl]ethyl]propane-1,3-diol;hydrochloride.
| Compound Name | 2-amino-2-[2-[4-[3-(3-fluorophenyl)propoxy]-3-(trifluoromethyl)phenyl]ethyl]propane-1,3-diol;hydrochloride |
|---|---|
| PubChem CID | 66594042 |
| Molecular Formula | C21H26ClF4NO3 |
| Molecular Weight | 451.89 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 2-amino-2-[2-[4-[3-(3-fluorophenyl)propoxy]-3-(trifluoromethyl)phenyl]ethyl]propane-1,3-diol;hydrochloride |
| SMILES | Cl.NC(CO)(CO)CCc1ccc(OCCCc2cccc(F)c2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H25F4NO3.ClH/c22-17-5-1-3-15(11-17)4-2-10-29-19-7-6-16(12-18(19)21(23,24)25)8-9-20(26,13-27)14-28;/h1,3,5-7,11-12,27-28H,2,4,8-10,13-14,26H2;1H |
| InChIKey | KXHQUOARJXKAFM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.89 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|