C19H24F3NO3S — CID 59407777
2-amino-2-[2-[4-(3-thiophen-2-ylpropoxy)-3-(trifluoromethyl)phenyl]ethyl]propane-1,3-diol (PubChem CID 59407777) has the molecular formula C19H24F3NO3S and a molecular weight of 403.47 g/mol. Its IUPAC name is 2-amino-2-[2-[4-(3-thiophen-2-ylpropoxy)-3-(trifluoromethyl)phenyl]ethyl]propane-1,3-diol.
| Compound Name | 2-amino-2-[2-[4-(3-thiophen-2-ylpropoxy)-3-(trifluoromethyl)phenyl]ethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 59407777 |
| Molecular Formula | C19H24F3NO3S |
| Molecular Weight | 403.47 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 2-amino-2-[2-[4-(3-thiophen-2-ylpropoxy)-3-(trifluoromethyl)phenyl]ethyl]propane-1,3-diol |
| SMILES | NC(CO)(CO)CCc1ccc(OCCCc2cccs2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H24F3NO3S/c20-19(21,22)16-11-14(7-8-18(23,12-24)13-25)5-6-17(16)26-9-1-3-15-4-2-10-27-15/h2,4-6,10-11,24-25H,1,3,7-9,12-13,23H2 |
| InChIKey | MDKWYQKFRGUQIA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|