C18H26F3NO3 — CID 89142973
2-amino-2-[2-[4-hex-5-enoxy-3-(trifluoromethyl)phenyl]ethyl]propane-1,3-diol (PubChem CID 89142973) has the molecular formula C18H26F3NO3 and a molecular weight of 361.40 g/mol. Its IUPAC name is 2-amino-2-[2-[4-hex-5-enoxy-3-(trifluoromethyl)phenyl]ethyl]propane-1,3-diol.
| Compound Name | 2-amino-2-[2-[4-hex-5-enoxy-3-(trifluoromethyl)phenyl]ethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 89142973 |
| Molecular Formula | C18H26F3NO3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 2-amino-2-[2-[4-hex-5-enoxy-3-(trifluoromethyl)phenyl]ethyl]propane-1,3-diol |
| SMILES | C=CCCCCOc1ccc(CCC(N)(CO)CO)cc1C(F)(F)F |
| InChI | InChI=1S/C18H26F3NO3/c1-2-3-4-5-10-25-16-7-6-14(11-15(16)18(19,20)21)8-9-17(22,12-23)13-24/h2,6-7,11,23-24H,1,3-5,8-10,12-13,22H2 |
| InChIKey | DUZVKJSHMPGOIQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|