C19H28F3NO3 — CID 70963783
2-amino-2-[2-[4-[(E)-hept-2-enoxy]-3-(trifluoromethyl)phenyl]ethyl]propane-1,3-diol (PubChem CID 70963783) has the molecular formula C19H28F3NO3 and a molecular weight of 375.43 g/mol. Its IUPAC name is 2-amino-2-[2-[4-[(E)-hept-2-enoxy]-3-(trifluoromethyl)phenyl]ethyl]propane-1,3-diol.
| Compound Name | 2-amino-2-[2-[4-[(E)-hept-2-enoxy]-3-(trifluoromethyl)phenyl]ethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 70963783 |
| Molecular Formula | C19H28F3NO3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 2-amino-2-[2-[4-[(E)-hept-2-enoxy]-3-(trifluoromethyl)phenyl]ethyl]propane-1,3-diol |
| SMILES | CCCC/C=C/COc1ccc(CCC(N)(CO)CO)cc1C(F)(F)F |
| InChI | InChI=1S/C19H28F3NO3/c1-2-3-4-5-6-11-26-17-8-7-15(12-16(17)19(20,21)22)9-10-18(23,13-24)14-25/h5-8,12,24-25H,2-4,9-11,13-14,23H2,1H3/b6-5+ |
| InChIKey | MSHQUKPULHSDSL-AATRIKPKSA-N |
| XLogP | 3.45 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|