C21H26BrF3NO6P — CID 59407845
[2-amino-4-[4-[3-(3-bromophenyl)propoxy]-3-(trifluoromethyl)phenyl]-2-(hydroxymethyl)butyl] dihydrogen phosphate (PubChem CID 59407845) has the molecular formula C21H26BrF3NO6P and a molecular weight of 556.31 g/mol. Its IUPAC name is [2-amino-4-[4-[3-(3-bromophenyl)propoxy]-3-(trifluoromethyl)phenyl]-2-(hydroxymethyl)butyl] dihydrogen phosphate.
| Compound Name | [2-amino-4-[4-[3-(3-bromophenyl)propoxy]-3-(trifluoromethyl)phenyl]-2-(hydroxymethyl)butyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 59407845 |
| Molecular Formula | C21H26BrF3NO6P |
| Molecular Weight | 556.31 g/mol |
| Exact Mass | 555.06 |
| IUPAC Name | [2-amino-4-[4-[3-(3-bromophenyl)propoxy]-3-(trifluoromethyl)phenyl]-2-(hydroxymethyl)butyl] dihydrogen phosphate |
| SMILES | NC(CO)(CCc1ccc(OCCCc2cccc(Br)c2)c(C(F)(F)F)c1)COP(=O)(O)O |
| InChI | InChI=1S/C21H26BrF3NO6P/c22-17-5-1-3-15(11-17)4-2-10-31-19-7-6-16(12-18(19)21(23,24)25)8-9-20(26,13-27)14-32-33(28,29)30/h1,3,5-7,11-12,27H,2,4,8-10,13-14,26H2,(H2,28,29,30) |
| InChIKey | QIKAKNOYUSUJIK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.31 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|