C24H29F6NO3 — CID 162545114
2-amino-2-[2-[4-[3-[3-(trifluoromethoxy)phenyl]propoxy]-3-(trifluoromethyl)phenyl]ethyl]pentan-1-ol (PubChem CID 162545114) has the molecular formula C24H29F6NO3 and a molecular weight of 493.49 g/mol. Its IUPAC name is 2-amino-2-[2-[4-[3-[3-(trifluoromethoxy)phenyl]propoxy]-3-(trifluoromethyl)phenyl]ethyl]pentan-1-ol.
| Compound Name | 2-amino-2-[2-[4-[3-[3-(trifluoromethoxy)phenyl]propoxy]-3-(trifluoromethyl)phenyl]ethyl]pentan-1-ol |
|---|---|
| PubChem CID | 162545114 |
| Molecular Formula | C24H29F6NO3 |
| Molecular Weight | 493.49 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | 2-amino-2-[2-[4-[3-[3-(trifluoromethoxy)phenyl]propoxy]-3-(trifluoromethyl)phenyl]ethyl]pentan-1-ol |
| SMILES | CCCC(N)(CO)CCc1ccc(OCCCc2cccc(OC(F)(F)F)c2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H29F6NO3/c1-2-11-22(31,16-32)12-10-18-8-9-21(20(15-18)23(25,26)27)33-13-4-6-17-5-3-7-19(14-17)34-24(28,29)30/h3,5,7-9,14-15,32H,2,4,6,10-13,16,31H2,1H3 |
| InChIKey | APFIZGIKZFSLCM-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.49 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|