C21H23ClF6O3 — CID 159480630
1-[4-[3-[3-(trifluoromethoxy)phenyl]propoxy]-3-(trifluoromethyl)phenyl]butan-1-ol;hydrochloride (PubChem CID 159480630) has the molecular formula C21H23ClF6O3 and a molecular weight of 472.85 g/mol. Its IUPAC name is 1-[4-[3-[3-(trifluoromethoxy)phenyl]propoxy]-3-(trifluoromethyl)phenyl]butan-1-ol;hydrochloride.
| Compound Name | 1-[4-[3-[3-(trifluoromethoxy)phenyl]propoxy]-3-(trifluoromethyl)phenyl]butan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 159480630 |
| Molecular Formula | C21H23ClF6O3 |
| Molecular Weight | 472.85 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | 1-[4-[3-[3-(trifluoromethoxy)phenyl]propoxy]-3-(trifluoromethyl)phenyl]butan-1-ol;hydrochloride |
| SMILES | CCCC(O)c1ccc(OCCCc2cccc(OC(F)(F)F)c2)c(C(F)(F)F)c1.Cl |
| InChI | InChI=1S/C21H22F6O3.ClH/c1-2-5-18(28)15-9-10-19(17(13-15)20(22,23)24)29-11-4-7-14-6-3-8-16(12-14)30-21(25,26)27;/h3,6,8-10,12-13,18,28H,2,4-5,7,11H2,1H3;1H |
| InChIKey | LWYMIBVKAXUVDK-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.85 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|