C30H39F6NO6 — CID 86643455
tert-butyl N-[3-(methoxymethoxymethyl)-1-[4-[3-[3-(trifluoromethoxy)phenyl]propoxy]-3-(trifluoromethyl)phenyl]pentan-3-yl]carbamate (PubChem CID 86643455) has the molecular formula C30H39F6NO6 and a molecular weight of 623.63 g/mol. Its IUPAC name is tert-butyl N-[3-(methoxymethoxymethyl)-1-[4-[3-[3-(trifluoromethoxy)phenyl]propoxy]-3-(trifluoromethyl)phenyl]pentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[3-(methoxymethoxymethyl)-1-[4-[3-[3-(trifluoromethoxy)phenyl]propoxy]-3-(trifluoromethyl)phenyl]pentan-3-yl]carbamate |
|---|---|
| PubChem CID | 86643455 |
| Molecular Formula | C30H39F6NO6 |
| Molecular Weight | 623.63 g/mol |
| Exact Mass | 623.27 |
| IUPAC Name | tert-butyl N-[3-(methoxymethoxymethyl)-1-[4-[3-[3-(trifluoromethoxy)phenyl]propoxy]-3-(trifluoromethyl)phenyl]pentan-3-yl]carbamate |
| SMILES | CCC(CCc1ccc(OCCCc2cccc(OC(F)(F)F)c2)c(C(F)(F)F)c1)(COCOC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H39F6NO6/c1-6-28(19-40-20-39-5,37-26(38)43-27(2,3)4)15-14-22-12-13-25(24(18-22)29(31,32)33)41-16-8-10-21-9-7-11-23(17-21)42-30(34,35)36/h7,9,11-13,17-18H,6,8,10,14-16,19-20H2,1-5H3,(H,37,38) |
| InChIKey | ZORHFXJNVWXAGY-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.63 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|