C29H37F6NO6 — CID 59407960
tert-butyl N-[1-(methoxymethoxy)-2-methyl-4-[4-[3-[3-(trifluoromethoxy)phenyl]propoxy]-3-(trifluoromethyl)phenyl]butan-2-yl]carbamate (PubChem CID 59407960) has the molecular formula C29H37F6NO6 and a molecular weight of 609.60 g/mol. Its IUPAC name is tert-butyl N-[1-(methoxymethoxy)-2-methyl-4-[4-[3-[3-(trifluoromethoxy)phenyl]propoxy]-3-(trifluoromethyl)phenyl]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(methoxymethoxy)-2-methyl-4-[4-[3-[3-(trifluoromethoxy)phenyl]propoxy]-3-(trifluoromethyl)phenyl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 59407960 |
| Molecular Formula | C29H37F6NO6 |
| Molecular Weight | 609.60 g/mol |
| Exact Mass | 609.25 |
| IUPAC Name | tert-butyl N-[1-(methoxymethoxy)-2-methyl-4-[4-[3-[3-(trifluoromethoxy)phenyl]propoxy]-3-(trifluoromethyl)phenyl]butan-2-yl]carbamate |
| SMILES | COCOCC(C)(CCc1ccc(OCCCc2cccc(OC(F)(F)F)c2)c(C(F)(F)F)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H37F6NO6/c1-26(2,3)42-25(37)36-27(4,18-39-19-38-5)14-13-21-11-12-24(23(17-21)28(30,31)32)40-15-7-9-20-8-6-10-22(16-20)41-29(33,34)35/h6,8,10-12,16-17H,7,9,13-15,18-19H2,1-5H3,(H,36,37) |
| InChIKey | QXAACYXUEDQECZ-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.60 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|