C44H44F6NO6P — CID 87064549
benzyl N-[1-dibenzylphosphoryloxy-2-methyl-4-[4-[3-[3-(trifluoromethoxy)phenyl]propoxy]-3-(trifluoromethyl)phenyl]butan-2-yl]carbamate (PubChem CID 87064549) has the molecular formula C44H44F6NO6P and a molecular weight of 827.80 g/mol. Its IUPAC name is benzyl N-[1-dibenzylphosphoryloxy-2-methyl-4-[4-[3-[3-(trifluoromethoxy)phenyl]propoxy]-3-(trifluoromethyl)phenyl]butan-2-yl]carbamate.
| Compound Name | benzyl N-[1-dibenzylphosphoryloxy-2-methyl-4-[4-[3-[3-(trifluoromethoxy)phenyl]propoxy]-3-(trifluoromethyl)phenyl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 87064549 |
| Molecular Formula | C44H44F6NO6P |
| Molecular Weight | 827.80 g/mol |
| Exact Mass | 827.28 |
| IUPAC Name | benzyl N-[1-dibenzylphosphoryloxy-2-methyl-4-[4-[3-[3-(trifluoromethoxy)phenyl]propoxy]-3-(trifluoromethyl)phenyl]butan-2-yl]carbamate |
| SMILES | CC(CCc1ccc(OCCCc2cccc(OC(F)(F)F)c2)c(C(F)(F)F)c1)(COP(=O)(Cc1ccccc1)Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C44H44F6NO6P/c1-42(51-41(52)55-29-35-13-5-2-6-14-35,32-56-58(53,30-36-15-7-3-8-16-36)31-37-17-9-4-10-18-37)25-24-34-22-23-40(39(28-34)43(45,46)47)54-26-12-20-33-19-11-21-38(27-33)57-44(48,49)50/h2-11,13-19,21-23,27-28H,12,20,24-26,29-32H2,1H3,(H,51,52) |
| InChIKey | WAYCMPTUNJAVAN-UHFFFAOYSA-N |
| XLogP | 11.93 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.80 |
| LogP ≤ 5 | 11.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|