C27H44F3NO5 — CID 67417816
tert-butyl N-[4-[4-heptoxy-3-(trifluoromethyl)phenyl]-4-(methoxymethoxy)hexyl]carbamate (PubChem CID 67417816) has the molecular formula C27H44F3NO5 and a molecular weight of 519.65 g/mol. Its IUPAC name is tert-butyl N-[4-[4-heptoxy-3-(trifluoromethyl)phenyl]-4-(methoxymethoxy)hexyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-heptoxy-3-(trifluoromethyl)phenyl]-4-(methoxymethoxy)hexyl]carbamate |
|---|---|
| PubChem CID | 67417816 |
| Molecular Formula | C27H44F3NO5 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.32 |
| IUPAC Name | tert-butyl N-[4-[4-heptoxy-3-(trifluoromethyl)phenyl]-4-(methoxymethoxy)hexyl]carbamate |
| SMILES | CCCCCCCOc1ccc(C(CC)(CCCNC(=O)OC(C)(C)C)OCOC)cc1C(F)(F)F |
| InChI | InChI=1S/C27H44F3NO5/c1-7-9-10-11-12-18-34-23-15-14-21(19-22(23)27(28,29)30)26(8-2,35-20-33-6)16-13-17-31-24(32)36-25(3,4)5/h14-15,19H,7-13,16-18,20H2,1-6H3,(H,31,32) |
| InChIKey | NJHWLUSPYZCJKS-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|