C25H39NO5 — CID 58897682
(E,4R)-6-(4-heptoxyphenyl)-4-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hex-2-enoic acid (PubChem CID 58897682) has the molecular formula C25H39NO5 and a molecular weight of 433.59 g/mol. Its IUPAC name is (E,4R)-6-(4-heptoxyphenyl)-4-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hex-2-enoic acid.
| Compound Name | (E,4R)-6-(4-heptoxyphenyl)-4-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hex-2-enoic acid |
|---|---|
| PubChem CID | 58897682 |
| Molecular Formula | C25H39NO5 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | (E,4R)-6-(4-heptoxyphenyl)-4-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hex-2-enoic acid |
| SMILES | CCCCCCCOc1ccc(CC[C@](C)(/C=C/C(=O)O)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C25H39NO5/c1-6-7-8-9-10-19-30-21-13-11-20(12-14-21)15-17-25(5,18-16-22(27)28)26-23(29)31-24(2,3)4/h11-14,16,18H,6-10,15,17,19H2,1-5H3,(H,26,29)(H,27,28)/b18-16+/t25-/m1/s1 |
| InChIKey | IKJMLQGRJVBUHN-QQDPUAARSA-N |
| XLogP | 5.89 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|