C24H38N2O3 — CID 68583507
tert-butyl N-[(2R)-1-cyano-4-(4-heptoxyphenyl)-2-methylbutan-2-yl]carbamate (PubChem CID 68583507) has the molecular formula C24H38N2O3 and a molecular weight of 402.58 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-cyano-4-(4-heptoxyphenyl)-2-methylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-cyano-4-(4-heptoxyphenyl)-2-methylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 68583507 |
| Molecular Formula | C24H38N2O3 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.29 |
| IUPAC Name | tert-butyl N-[(2R)-1-cyano-4-(4-heptoxyphenyl)-2-methylbutan-2-yl]carbamate |
| SMILES | CCCCCCCOc1ccc(CC[C@](C)(CC#N)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C24H38N2O3/c1-6-7-8-9-10-19-28-21-13-11-20(12-14-21)15-16-24(5,17-18-25)26-22(27)29-23(2,3)4/h11-14H,6-10,15-17,19H2,1-5H3,(H,26,27)/t24-/m1/s1 |
| InChIKey | KEPOULQAAPIWEU-XMMPIXPASA-N |
| XLogP | 6.17 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|