C25H32O4 — CID 70552408
diethyl 2-[3-(4-methylphenyl)propyl]-2-(2-phenylethyl)propanedioate (PubChem CID 70552408) has the molecular formula C25H32O4 and a molecular weight of 396.53 g/mol. Its IUPAC name is diethyl 2-[3-(4-methylphenyl)propyl]-2-(2-phenylethyl)propanedioate.
| Compound Name | diethyl 2-[3-(4-methylphenyl)propyl]-2-(2-phenylethyl)propanedioate |
|---|---|
| PubChem CID | 70552408 |
| Molecular Formula | C25H32O4 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | diethyl 2-[3-(4-methylphenyl)propyl]-2-(2-phenylethyl)propanedioate |
| SMILES | CCOC(=O)C(CCCc1ccc(C)cc1)(CCc1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C25H32O4/c1-4-28-23(26)25(24(27)29-5-2,19-17-21-10-7-6-8-11-21)18-9-12-22-15-13-20(3)14-16-22/h6-8,10-11,13-16H,4-5,9,12,17-19H2,1-3H3 |
| InChIKey | KMPSCEMRQMCSCW-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|