C26H34O4 — CID 70551045
diethyl 2-[2-(2,4-dimethylphenyl)ethyl]-2-[2-(4-methylphenyl)ethyl]propanedioate (PubChem CID 70551045) has the molecular formula C26H34O4 and a molecular weight of 410.55 g/mol. Its IUPAC name is diethyl 2-[2-(2,4-dimethylphenyl)ethyl]-2-[2-(4-methylphenyl)ethyl]propanedioate.
| Compound Name | diethyl 2-[2-(2,4-dimethylphenyl)ethyl]-2-[2-(4-methylphenyl)ethyl]propanedioate |
|---|---|
| PubChem CID | 70551045 |
| Molecular Formula | C26H34O4 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | diethyl 2-[2-(2,4-dimethylphenyl)ethyl]-2-[2-(4-methylphenyl)ethyl]propanedioate |
| SMILES | CCOC(=O)C(CCc1ccc(C)cc1)(CCc1ccc(C)cc1C)C(=O)OCC |
| InChI | InChI=1S/C26H34O4/c1-6-29-24(27)26(25(28)30-7-2,16-14-22-11-8-19(3)9-12-22)17-15-23-13-10-20(4)18-21(23)5/h8-13,18H,6-7,14-17H2,1-5H3 |
| InChIKey | TXLOSDGDAYVOIK-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|