C23H37NO6Si — CID 139768355
diethyl 2-acetamido-2-[2-[4-(3-trimethylsilylpropoxy)phenyl]ethyl]propanedioate (PubChem CID 139768355) has the molecular formula C23H37NO6Si and a molecular weight of 451.64 g/mol. Its IUPAC name is diethyl 2-acetamido-2-[2-[4-(3-trimethylsilylpropoxy)phenyl]ethyl]propanedioate.
| Compound Name | diethyl 2-acetamido-2-[2-[4-(3-trimethylsilylpropoxy)phenyl]ethyl]propanedioate |
|---|---|
| PubChem CID | 139768355 |
| Molecular Formula | C23H37NO6Si |
| Molecular Weight | 451.64 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | diethyl 2-acetamido-2-[2-[4-(3-trimethylsilylpropoxy)phenyl]ethyl]propanedioate |
| SMILES | CCOC(=O)C(CCc1ccc(OCCC[Si](C)(C)C)cc1)(NC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C23H37NO6Si/c1-7-28-21(26)23(24-18(3)25,22(27)29-8-2)15-14-19-10-12-20(13-11-19)30-16-9-17-31(4,5)6/h10-13H,7-9,14-17H2,1-6H3,(H,24,25) |
| InChIKey | GZIFKNCYGSZSHF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.64 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|