C29H41NO6Si — CID 139768269
diethyl 2-acetamido-2-[2-[4-[4-[dimethyl(phenyl)silyl]butoxy]phenyl]ethyl]propanedioate (PubChem CID 139768269) has the molecular formula C29H41NO6Si and a molecular weight of 527.73 g/mol. Its IUPAC name is diethyl 2-acetamido-2-[2-[4-[4-[dimethyl(phenyl)silyl]butoxy]phenyl]ethyl]propanedioate.
| Compound Name | diethyl 2-acetamido-2-[2-[4-[4-[dimethyl(phenyl)silyl]butoxy]phenyl]ethyl]propanedioate |
|---|---|
| PubChem CID | 139768269 |
| Molecular Formula | C29H41NO6Si |
| Molecular Weight | 527.73 g/mol |
| Exact Mass | 527.27 |
| IUPAC Name | diethyl 2-acetamido-2-[2-[4-[4-[dimethyl(phenyl)silyl]butoxy]phenyl]ethyl]propanedioate |
| SMILES | CCOC(=O)C(CCc1ccc(OCCCC[Si](C)(C)c2ccccc2)cc1)(NC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C29H41NO6Si/c1-6-34-27(32)29(30-23(3)31,28(33)35-7-2)20-19-24-15-17-25(18-16-24)36-21-11-12-22-37(4,5)26-13-9-8-10-14-26/h8-10,13-18H,6-7,11-12,19-22H2,1-5H3,(H,30,31) |
| InChIKey | ADEOGOWUQQTLIJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.73 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|