C24H37NO3Si — CID 139768141
2-amino-2-[2-[4-[4-[benzyl(dimethyl)silyl]butoxy]phenyl]ethyl]propane-1,3-diol (PubChem CID 139768141) has the molecular formula C24H37NO3Si and a molecular weight of 415.65 g/mol. Its IUPAC name is 2-amino-2-[2-[4-[4-[benzyl(dimethyl)silyl]butoxy]phenyl]ethyl]propane-1,3-diol.
| Compound Name | 2-amino-2-[2-[4-[4-[benzyl(dimethyl)silyl]butoxy]phenyl]ethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 139768141 |
| Molecular Formula | C24H37NO3Si |
| Molecular Weight | 415.65 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | 2-amino-2-[2-[4-[4-[benzyl(dimethyl)silyl]butoxy]phenyl]ethyl]propane-1,3-diol |
| SMILES | C[Si](C)(CCCCOc1ccc(CCC(N)(CO)CO)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H37NO3Si/c1-29(2,18-22-8-4-3-5-9-22)17-7-6-16-28-23-12-10-21(11-13-23)14-15-24(25,19-26)20-27/h3-5,8-13,26-27H,6-7,14-20,25H2,1-2H3 |
| InChIKey | NVUABVDHHPQLBX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.65 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|