C23H36ClNO3Si — CID 139768331
2-amino-2-[2-[4-[3-[benzyl(dimethyl)silyl]propoxy]phenyl]ethyl]propane-1,3-diol;hydrochloride (PubChem CID 139768331) has the molecular formula C23H36ClNO3Si and a molecular weight of 438.08 g/mol. Its IUPAC name is 2-amino-2-[2-[4-[3-[benzyl(dimethyl)silyl]propoxy]phenyl]ethyl]propane-1,3-diol;hydrochloride.
| Compound Name | 2-amino-2-[2-[4-[3-[benzyl(dimethyl)silyl]propoxy]phenyl]ethyl]propane-1,3-diol;hydrochloride |
|---|---|
| PubChem CID | 139768331 |
| Molecular Formula | C23H36ClNO3Si |
| Molecular Weight | 438.08 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 2-amino-2-[2-[4-[3-[benzyl(dimethyl)silyl]propoxy]phenyl]ethyl]propane-1,3-diol;hydrochloride |
| SMILES | C[Si](C)(CCCOc1ccc(CCC(N)(CO)CO)cc1)Cc1ccccc1.Cl |
| InChI | InChI=1S/C23H35NO3Si.ClH/c1-28(2,17-21-7-4-3-5-8-21)16-6-15-27-22-11-9-20(10-12-22)13-14-23(24,18-25)19-26;/h3-5,7-12,25-26H,6,13-19,24H2,1-2H3;1H |
| InChIKey | DDKYTQHLESZVGF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.08 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|