C31H39NO5Si — CID 139768392
diethyl 2-amino-2-[2-[4-[3-[methyl(diphenyl)silyl]propoxy]phenyl]ethyl]propanedioate (PubChem CID 139768392) has the molecular formula C31H39NO5Si and a molecular weight of 533.74 g/mol. Its IUPAC name is diethyl 2-amino-2-[2-[4-[3-[methyl(diphenyl)silyl]propoxy]phenyl]ethyl]propanedioate.
| Compound Name | diethyl 2-amino-2-[2-[4-[3-[methyl(diphenyl)silyl]propoxy]phenyl]ethyl]propanedioate |
|---|---|
| PubChem CID | 139768392 |
| Molecular Formula | C31H39NO5Si |
| Molecular Weight | 533.74 g/mol |
| Exact Mass | 533.26 |
| IUPAC Name | diethyl 2-amino-2-[2-[4-[3-[methyl(diphenyl)silyl]propoxy]phenyl]ethyl]propanedioate |
| SMILES | CCOC(=O)C(N)(CCc1ccc(OCCC[Si](C)(c2ccccc2)c2ccccc2)cc1)C(=O)OCC |
| InChI | InChI=1S/C31H39NO5Si/c1-4-35-29(33)31(32,30(34)36-5-2)22-21-25-17-19-26(20-18-25)37-23-12-24-38(3,27-13-8-6-9-14-27)28-15-10-7-11-16-28/h6-11,13-20H,4-5,12,21-24,32H2,1-3H3 |
| InChIKey | MWHKEIMFLGCURC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.74 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|